C9H19F3N2O — CID 104840399
3-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]pentan-1-ol (PubChem CID 104840399) has the molecular formula C9H19F3N2O and a molecular weight of 228.26 g/mol. Its IUPAC name is 3-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]pentan-1-ol.
| Compound Name | 3-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 104840399 |
| Molecular Formula | C9H19F3N2O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]pentan-1-ol |
| SMILES | CCC(N)C(CO)N(CC)CC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O/c1-3-7(13)8(5-15)14(4-2)6-9(10,11)12/h7-8,15H,3-6,13H2,1-2H3 |
| InChIKey | HTORRJHWGHLOAA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |