C10H16N2S — CID 104840931
(2-cyclobutyl-4-ethyl-1,3-thiazol-5-yl)methanamine (PubChem CID 104840931) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is (2-cyclobutyl-4-ethyl-1,3-thiazol-5-yl)methanamine.
| Compound Name | (2-cyclobutyl-4-ethyl-1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 104840931 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (2-cyclobutyl-4-ethyl-1,3-thiazol-5-yl)methanamine |
| SMILES | CCc1nc(C2CCC2)sc1CN |
| InChI | InChI=1S/C10H16N2S/c1-2-8-9(6-11)13-10(12-8)7-4-3-5-7/h7H,2-6,11H2,1H3 |
| InChIKey | YJNBPJAPGOXUFH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |