C11H18N2S2 — CID 114361282
[4-propyl-2-(thiolan-2-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 114361282) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is [4-propyl-2-(thiolan-2-yl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [4-propyl-2-(thiolan-2-yl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 114361282 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [4-propyl-2-(thiolan-2-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CCCc1nc(C2CCCS2)sc1CN |
| InChI | InChI=1S/C11H18N2S2/c1-2-4-8-10(7-12)15-11(13-8)9-5-3-6-14-9/h9H,2-7,12H2,1H3 |
| InChIKey | LAFQYMAHHHPVBX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |