C9H9IN4S — CID 104841516
5-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyrimidin-2-amine (PubChem CID 104841516) has the molecular formula C9H9IN4S and a molecular weight of 332.17 g/mol. Its IUPAC name is 5-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 104841516 |
| Molecular Formula | C9H9IN4S |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 5-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pyrimidin-2-amine |
| SMILES | CN(Cc1cscn1)c1ncc(I)cn1 |
| InChI | InChI=1S/C9H9IN4S/c1-14(4-8-5-15-6-13-8)9-11-2-7(10)3-12-9/h2-3,5-6H,4H2,1H3 |
| InChIKey | KUEBSHCKUWUTGO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|