C11H11IN2S — CID 91268064
4-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 91268064) has the molecular formula C11H11IN2S and a molecular weight of 330.19 g/mol. Its IUPAC name is 4-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 4-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 91268064 |
| Molecular Formula | C11H11IN2S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 4-iodo-N-methyl-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | CN(Cc1cscn1)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H11IN2S/c1-14(6-10-7-15-8-13-10)11-4-2-9(12)3-5-11/h2-5,7-8H,6H2,1H3 |
| InChIKey | KPPNZJXEFKFBCH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|