C13H15ClN2S — CID 62128963
4-(chloromethyl)-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 62128963) has the molecular formula C13H15ClN2S and a molecular weight of 266.80 g/mol. Its IUPAC name is 4-(chloromethyl)-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 4-(chloromethyl)-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 62128963 |
| Molecular Formula | C13H15ClN2S |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-(chloromethyl)-N,3-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Cc1cc(N(C)Cc2cscn2)ccc1CCl |
| InChI | InChI=1S/C13H15ClN2S/c1-10-5-13(4-3-11(10)6-14)16(2)7-12-8-17-9-15-12/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | DQDAJKMPUOEBAP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|