C10H19N3OS — CID 104842276
3-amino-2-(2,5-dimethylpyrazol-3-yl)sulfanylpentan-1-ol (PubChem CID 104842276) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 3-amino-2-(2,5-dimethylpyrazol-3-yl)sulfanylpentan-1-ol.
| Compound Name | 3-amino-2-(2,5-dimethylpyrazol-3-yl)sulfanylpentan-1-ol |
|---|---|
| PubChem CID | 104842276 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 3-amino-2-(2,5-dimethylpyrazol-3-yl)sulfanylpentan-1-ol |
| SMILES | CCC(N)C(CO)Sc1cc(C)nn1C |
| InChI | InChI=1S/C10H19N3OS/c1-4-8(11)9(6-14)15-10-5-7(2)12-13(10)3/h5,8-9,14H,4,6,11H2,1-3H3 |
| InChIKey | KUYDZMPLAFHLED-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |