C15H18Cl3NO — CID 104842863
2-methyl-N-[(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-2-amine (PubChem CID 104842863) has the molecular formula C15H18Cl3NO and a molecular weight of 334.67 g/mol. Its IUPAC name is 2-methyl-N-[(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 104842863 |
| Molecular Formula | C15H18Cl3NO |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-methyl-N-[(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-2-amine |
| SMILES | CCc1c(CNC(C)(C)C)oc2c(Cl)cc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C15H18Cl3NO/c1-5-8-11(7-19-15(2,3)4)20-14-10(17)6-9(16)13(18)12(8)14/h6,19H,5,7H2,1-4H3 |
| InChIKey | MFSSVVGHVMTHGF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|