C12H12Cl3NO — CID 104842865
N-methyl-1-(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methanamine (PubChem CID 104842865) has the molecular formula C12H12Cl3NO and a molecular weight of 292.59 g/mol. Its IUPAC name is N-methyl-1-(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methanamine.
| Compound Name | N-methyl-1-(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 104842865 |
| Molecular Formula | C12H12Cl3NO |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | N-methyl-1-(4,5,7-trichloro-3-ethyl-1-benzofuran-2-yl)methanamine |
| SMILES | CCc1c(CNC)oc2c(Cl)cc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C12H12Cl3NO/c1-3-6-9(5-16-2)17-12-8(14)4-7(13)11(15)10(6)12/h4,16H,3,5H2,1-2H3 |
| InChIKey | RXQPKWVNKRVJCF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|