C13H16BrNO — CID 104843160
1-(5-bromo-3-ethyl-7-methyl-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 104843160) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 1-(5-bromo-3-ethyl-7-methyl-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-3-ethyl-7-methyl-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 104843160 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-(5-bromo-3-ethyl-7-methyl-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CCc1c(CNC)oc2c(C)cc(Br)cc12 |
| InChI | InChI=1S/C13H16BrNO/c1-4-10-11-6-9(14)5-8(2)13(11)16-12(10)7-15-3/h5-6,15H,4,7H2,1-3H3 |
| InChIKey | VNJBWIIPCGZGFB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |