C14H19NO — CID 104843083
1-(3,7-diethyl-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 104843083) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(3,7-diethyl-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3,7-diethyl-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 104843083 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(3,7-diethyl-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CCc1c(CNC)oc2c(CC)cccc12 |
| InChI | InChI=1S/C14H19NO/c1-4-10-7-6-8-12-11(5-2)13(9-15-3)16-14(10)12/h6-8,15H,4-5,9H2,1-3H3 |
| InChIKey | XDECOWJVPQUETE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |