C16H22BrNO — CID 104842925
N-[(7-bromo-3-ethyl-5-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine (PubChem CID 104842925) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is N-[(7-bromo-3-ethyl-5-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(7-bromo-3-ethyl-5-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 104842925 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(7-bromo-3-ethyl-5-methyl-1-benzofuran-2-yl)methyl]-2-methylpropan-1-amine |
| SMILES | CCc1c(CNCC(C)C)oc2c(Br)cc(C)cc12 |
| InChI | InChI=1S/C16H22BrNO/c1-5-12-13-6-11(4)7-14(17)16(13)19-15(12)9-18-8-10(2)3/h6-7,10,18H,5,8-9H2,1-4H3 |
| InChIKey | CTXBWMQAQWOJDR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |