C15H20BrNO2 — CID 114376086
N-[[7-bromo-3-(methoxymethyl)-5-methyl-1-benzofuran-2-yl]methyl]propan-2-amine (PubChem CID 114376086) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is N-[[7-bromo-3-(methoxymethyl)-5-methyl-1-benzofuran-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[7-bromo-3-(methoxymethyl)-5-methyl-1-benzofuran-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 114376086 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[[7-bromo-3-(methoxymethyl)-5-methyl-1-benzofuran-2-yl]methyl]propan-2-amine |
| SMILES | COCc1c(CNC(C)C)oc2c(Br)cc(C)cc12 |
| InChI | InChI=1S/C15H20BrNO2/c1-9(2)17-7-14-12(8-18-4)11-5-10(3)6-13(16)15(11)19-14/h5-6,9,17H,7-8H2,1-4H3 |
| InChIKey | ZMESHBGXPQOSKS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |