C13H15BrFNO2 — CID 114376801
N-[[7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]ethanamine (PubChem CID 114376801) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is N-[[7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]ethanamine.
| Compound Name | N-[[7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 114376801 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[[7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methyl]ethanamine |
| SMILES | CCNCc1oc2c(Br)cc(F)cc2c1COC |
| InChI | InChI=1S/C13H15BrFNO2/c1-3-16-6-12-10(7-17-2)9-4-8(15)5-11(14)13(9)18-12/h4-5,16H,3,6-7H2,1-2H3 |
| InChIKey | STUHKACANMQZNK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |