C11H11BrFNO2 — CID 114376786
[7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methanamine (PubChem CID 114376786) has the molecular formula C11H11BrFNO2 and a molecular weight of 288.12 g/mol. Its IUPAC name is [7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methanamine.
| Compound Name | [7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methanamine |
|---|---|
| PubChem CID | 114376786 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | [7-bromo-5-fluoro-3-(methoxymethyl)-1-benzofuran-2-yl]methanamine |
| SMILES | COCc1c(CN)oc2c(Br)cc(F)cc12 |
| InChI | InChI=1S/C11H11BrFNO2/c1-15-5-8-7-2-6(13)3-9(12)11(7)16-10(8)4-14/h2-3H,4-5,14H2,1H3 |
| InChIKey | TYXRHBFORDXMIO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |