C13H17NOS — CID 104843379
1-(3-ethyl-7-methoxy-1-benzothiophen-2-yl)-N-methylmethanamine (PubChem CID 104843379) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-(3-ethyl-7-methoxy-1-benzothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-ethyl-7-methoxy-1-benzothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 104843379 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-(3-ethyl-7-methoxy-1-benzothiophen-2-yl)-N-methylmethanamine |
| SMILES | CCc1c(CNC)sc2c(OC)cccc12 |
| InChI | InChI=1S/C13H17NOS/c1-4-9-10-6-5-7-11(15-3)13(10)16-12(9)8-14-2/h5-7,14H,4,8H2,1-3H3 |
| InChIKey | IOXVHSKWCBFZTR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |