C16H23NOS — CID 114378379
N-[(7-methoxy-3-propyl-1-benzothiophen-2-yl)methyl]propan-1-amine (PubChem CID 114378379) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is N-[(7-methoxy-3-propyl-1-benzothiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(7-methoxy-3-propyl-1-benzothiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114378379 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[(7-methoxy-3-propyl-1-benzothiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1sc2c(OC)cccc2c1CCC |
| InChI | InChI=1S/C16H23NOS/c1-4-7-12-13-8-6-9-14(18-3)16(13)19-15(12)11-17-10-5-2/h6,8-9,17H,4-5,7,10-11H2,1-3H3 |
| InChIKey | RNCHVIRPXNRAOE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|