C16H22BrNS — CID 114378235
N-[[7-bromo-3-(2-methylpropyl)-1-benzothiophen-2-yl]methyl]propan-1-amine (PubChem CID 114378235) has the molecular formula C16H22BrNS and a molecular weight of 340.33 g/mol. Its IUPAC name is N-[[7-bromo-3-(2-methylpropyl)-1-benzothiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[7-bromo-3-(2-methylpropyl)-1-benzothiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114378235 |
| Molecular Formula | C16H22BrNS |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[[7-bromo-3-(2-methylpropyl)-1-benzothiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc2c(Br)cccc2c1CC(C)C |
| InChI | InChI=1S/C16H22BrNS/c1-4-8-18-10-15-13(9-11(2)3)12-6-5-7-14(17)16(12)19-15/h5-7,11,18H,4,8-10H2,1-3H3 |
| InChIKey | AYMDWDDZGJOUFY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|