C16H21BrFNO — CID 114377531
N-[[7-bromo-4-fluoro-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-1-amine (PubChem CID 114377531) has the molecular formula C16H21BrFNO and a molecular weight of 342.25 g/mol. Its IUPAC name is N-[[7-bromo-4-fluoro-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[7-bromo-4-fluoro-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114377531 |
| Molecular Formula | C16H21BrFNO |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[[7-bromo-4-fluoro-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1oc2c(Br)ccc(F)c2c1CC(C)C |
| InChI | InChI=1S/C16H21BrFNO/c1-4-7-19-9-14-11(8-10(2)3)15-13(18)6-5-12(17)16(15)20-14/h5-6,10,19H,4,7-9H2,1-3H3 |
| InChIKey | WFEQFKPSMKGGAG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|