C15H19Br2NO2 — CID 104843203
N-[(4,7-dibromo-3-ethyl-5-methoxy-1-benzofuran-2-yl)methyl]propan-1-amine (PubChem CID 104843203) has the molecular formula C15H19Br2NO2 and a molecular weight of 405.13 g/mol. Its IUPAC name is N-[(4,7-dibromo-3-ethyl-5-methoxy-1-benzofuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(4,7-dibromo-3-ethyl-5-methoxy-1-benzofuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104843203 |
| Molecular Formula | C15H19Br2NO2 |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | N-[(4,7-dibromo-3-ethyl-5-methoxy-1-benzofuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1oc2c(Br)cc(OC)c(Br)c2c1CC |
| InChI | InChI=1S/C15H19Br2NO2/c1-4-6-18-8-12-9(5-2)13-14(17)11(19-3)7-10(16)15(13)20-12/h7,18H,4-6,8H2,1-3H3 |
| InChIKey | YFNUMMCIOVZQBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|