C17H22FNO — CID 102990769
N-[[4-fluoro-7-methyl-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]cyclopropanamine (PubChem CID 102990769) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is N-[[4-fluoro-7-methyl-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-fluoro-7-methyl-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 102990769 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-[[4-fluoro-7-methyl-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(F)c2c(CC(C)C)c(CNC3CC3)oc12 |
| InChI | InChI=1S/C17H22FNO/c1-10(2)8-13-15(9-19-12-5-6-12)20-17-11(3)4-7-14(18)16(13)17/h4,7,10,12,19H,5-6,8-9H2,1-3H3 |
| InChIKey | YHMSWVWIQXISII-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |