C15H18FNO2 — CID 107663049
N-[[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]methyl]cyclopropanamine (PubChem CID 107663049) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is N-[[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107663049 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]methyl]cyclopropanamine |
| SMILES | COCc1c(CNC2CC2)oc2c(F)c(C)ccc12 |
| InChI | InChI=1S/C15H18FNO2/c1-9-3-6-11-12(8-18-2)13(7-17-10-4-5-10)19-15(11)14(9)16/h3,6,10,17H,4-5,7-8H2,1-2H3 |
| InChIKey | UDXVZRCOHGNBSU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |