C13H16FNO2 — CID 107663057
1-[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]-N-methylmethanamine (PubChem CID 107663057) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]-N-methylmethanamine.
| Compound Name | 1-[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107663057 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-[7-fluoro-3-(methoxymethyl)-6-methyl-1-benzofuran-2-yl]-N-methylmethanamine |
| SMILES | CNCc1oc2c(F)c(C)ccc2c1COC |
| InChI | InChI=1S/C13H16FNO2/c1-8-4-5-9-10(7-16-3)11(6-15-2)17-13(9)12(8)14/h4-5,15H,6-7H2,1-3H3 |
| InChIKey | KMQOJEXYQNHEJC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |