C12H18F3N3 — CID 104844820
N-[1-(1H-pyrazol-4-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 104844820) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is N-[1-(1H-pyrazol-4-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[1-(1H-pyrazol-4-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 104844820 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[1-(1H-pyrazol-4-yl)ethyl]-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CC(NC1CCC(C(F)(F)F)CC1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H18F3N3/c1-8(9-6-16-17-7-9)18-11-4-2-10(3-5-11)12(13,14)15/h6-8,10-11,18H,2-5H2,1H3,(H,16,17) |
| InChIKey | MCXAVZXKFRQKFX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |