C14H20F3NO — CID 104845241
2-methyl-1-phenyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 104845241) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-methyl-1-phenyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | 2-methyl-1-phenyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 104845241 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-methyl-1-phenyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CC(CCCOCC(F)(F)F)C(N)c1ccccc1 |
| InChI | InChI=1S/C14H20F3NO/c1-11(6-5-9-19-10-14(15,16)17)13(18)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10,18H2,1H3 |
| InChIKey | PDTPCGDRYFJWAX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|