C15H11ClN4O — CID 104849674
4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxybenzonitrile (PubChem CID 104849674) has the molecular formula C15H11ClN4O and a molecular weight of 298.73 g/mol. Its IUPAC name is 4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxybenzonitrile.
| Compound Name | 4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 104849674 |
| Molecular Formula | C15H11ClN4O |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1-n1c(CCl)nc2cccnc21 |
| InChI | InChI=1S/C15H11ClN4O/c1-21-13-7-10(9-17)4-5-12(13)20-14(8-16)19-11-3-2-6-18-15(11)20/h2-7H,8H2,1H3 |
| InChIKey | QLOXSBXAZXVUTJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|