C15H10Cl2N4 — CID 107809217
3-chloro-4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile (PubChem CID 107809217) has the molecular formula C15H10Cl2N4 and a molecular weight of 317.18 g/mol. Its IUPAC name is 3-chloro-4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile.
| Compound Name | 3-chloro-4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 107809217 |
| Molecular Formula | C15H10Cl2N4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-chloro-4-[2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]benzonitrile |
| SMILES | CC(Cl)c1nc2cccnc2n1-c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N4/c1-9(16)14-20-12-3-2-6-19-15(12)21(14)13-5-4-10(8-18)7-11(13)17/h2-7,9H,1H3 |
| InChIKey | CIFMUWKBPZLETJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|