C15H22N4O2 — CID 104850100
N-(4-carbamimidoyl-2-methoxyphenyl)-3-methylpiperidine-1-carboxamide (PubChem CID 104850100) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(4-carbamimidoyl-2-methoxyphenyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N-(4-carbamimidoyl-2-methoxyphenyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 104850100 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(4-carbamimidoyl-2-methoxyphenyl)-3-methylpiperidine-1-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)N2CCCC(C)C2)c(OC)c1 |
| InChI | InChI=1S/C15H22N4O2/c1-10-4-3-7-19(9-10)15(20)18-12-6-5-11(14(16)17)8-13(12)21-2/h5-6,8,10H,3-4,7,9H2,1-2H3,(H3,16,17)(H,18,20) |
| InChIKey | BEUHXLXSQWESEC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|