C10H11N3O — CID 104853459
5-[(1S)-1-azidoethyl]-2,3-dihydro-1-benzofuran (PubChem CID 104853459) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-[(1S)-1-azidoethyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[(1S)-1-azidoethyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104853459 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 5-[(1S)-1-azidoethyl]-2,3-dihydro-1-benzofuran |
| SMILES | C[C@H](N=[N+]=[N-])c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H11N3O/c1-7(12-13-11)8-2-3-10-9(6-8)4-5-14-10/h2-3,6-7H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | OKQPQVCOOWYMHM-ZETCQYMHSA-N |
| XLogP | 2.99 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|