C14H21NO4 — CID 104855839
2-[8-[(2R)-oxolane-2-carbonyl]-8-azabicyclo[3.2.1]octan-3-yl]acetic acid (PubChem CID 104855839) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-[8-[(2R)-oxolane-2-carbonyl]-8-azabicyclo[3.2.1]octan-3-yl]acetic acid.
| Compound Name | 2-[8-[(2R)-oxolane-2-carbonyl]-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
|---|---|
| PubChem CID | 104855839 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-[8-[(2R)-oxolane-2-carbonyl]-8-azabicyclo[3.2.1]octan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CC2CCC(C1)N2C(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C14H21NO4/c16-13(17)8-9-6-10-3-4-11(7-9)15(10)14(18)12-2-1-5-19-12/h9-12H,1-8H2,(H,16,17)/t9?,10?,11?,12-/m1/s1 |
| InChIKey | HRKLUEDZXLWWTH-XHUCQOSOSA-N |
| XLogP | 1.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |