C12H19NO3 — CID 103873635
(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-[(2S)-oxolan-2-yl]methanone (PubChem CID 103873635) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-[(2S)-oxolan-2-yl]methanone.
| Compound Name | (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 103873635 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C12H19NO3/c14-10-6-8-3-4-9(7-10)13(8)12(15)11-2-1-5-16-11/h8-11,14H,1-7H2/t8?,9?,10?,11-/m0/s1 |
| InChIKey | ZRYIEOVEUSFCBT-QUBJWBRDSA-N |
| XLogP | 0.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |