C11H19NO3 — CID 71683933
(3,5-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone (PubChem CID 71683933) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (3,5-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone.
| Compound Name | (3,5-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 71683933 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (3,5-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone |
| SMILES | CC1COCC(C)N1C(=O)C1CCCO1 |
| InChI | InChI=1S/C11H19NO3/c1-8-6-14-7-9(2)12(8)11(13)10-4-3-5-15-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | OKEVZYLGIAMLDA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |