C10H17NO3 — CID 110739759
(2-methyl-1,3-oxazinan-3-yl)-(oxolan-2-yl)methanone (PubChem CID 110739759) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (2-methyl-1,3-oxazinan-3-yl)-(oxolan-2-yl)methanone.
| Compound Name | (2-methyl-1,3-oxazinan-3-yl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 110739759 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2-methyl-1,3-oxazinan-3-yl)-(oxolan-2-yl)methanone |
| SMILES | CC1OCCCN1C(=O)C1CCCO1 |
| InChI | InChI=1S/C10H17NO3/c1-8-11(5-3-7-13-8)10(12)9-4-2-6-14-9/h8-9H,2-7H2,1H3 |
| InChIKey | SEEWGWZZSITGGQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |