C10H17NO2 — CID 110739832
cyclobutyl-(2-methyl-1,3-oxazinan-3-yl)methanone (PubChem CID 110739832) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is cyclobutyl-(2-methyl-1,3-oxazinan-3-yl)methanone.
| Compound Name | cyclobutyl-(2-methyl-1,3-oxazinan-3-yl)methanone |
|---|---|
| PubChem CID | 110739832 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | cyclobutyl-(2-methyl-1,3-oxazinan-3-yl)methanone |
| SMILES | CC1OCCCN1C(=O)C1CCC1 |
| InChI | InChI=1S/C10H17NO2/c1-8-11(6-3-7-13-8)10(12)9-4-2-5-9/h8-9H,2-7H2,1H3 |
| InChIKey | FDUAFHFQEIOJHD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |