C15H17NO4 — CID 104855867
2-[1-[(2S)-oxolane-2-carbonyl]-2,3-dihydroindol-3-yl]acetic acid (PubChem CID 104855867) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[1-[(2S)-oxolane-2-carbonyl]-2,3-dihydroindol-3-yl]acetic acid.
| Compound Name | 2-[1-[(2S)-oxolane-2-carbonyl]-2,3-dihydroindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 104855867 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[1-[(2S)-oxolane-2-carbonyl]-2,3-dihydroindol-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)[C@@H]2CCCO2)c2ccccc21 |
| InChI | InChI=1S/C15H17NO4/c17-14(18)8-10-9-16(12-5-2-1-4-11(10)12)15(19)13-6-3-7-20-13/h1-2,4-5,10,13H,3,6-9H2,(H,17,18)/t10?,13-/m0/s1 |
| InChIKey | ZPPBNLHXYHYHNI-HQVZTVAUSA-N |
| XLogP | 1.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |