C16H19NO4 — CID 110672619
methyl 2-[1-(oxolane-2-carbonyl)-2,3-dihydroindol-3-yl]acetate (PubChem CID 110672619) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-[1-(oxolane-2-carbonyl)-2,3-dihydroindol-3-yl]acetate.
| Compound Name | methyl 2-[1-(oxolane-2-carbonyl)-2,3-dihydroindol-3-yl]acetate |
|---|---|
| PubChem CID | 110672619 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-[1-(oxolane-2-carbonyl)-2,3-dihydroindol-3-yl]acetate |
| SMILES | COC(=O)CC1CN(C(=O)C2CCCO2)c2ccccc21 |
| InChI | InChI=1S/C16H19NO4/c1-20-15(18)9-11-10-17(13-6-3-2-5-12(11)13)16(19)14-7-4-8-21-14/h2-3,5-6,11,14H,4,7-10H2,1H3 |
| InChIKey | PNTFHFZWGCTOAU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |