C19H19NO3 — CID 52904842
methyl 2-[(3S)-1-(4-methylbenzoyl)-2,3-dihydroindol-3-yl]acetate (PubChem CID 52904842) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is methyl 2-[(3S)-1-(4-methylbenzoyl)-2,3-dihydroindol-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-1-(4-methylbenzoyl)-2,3-dihydroindol-3-yl]acetate |
|---|---|
| PubChem CID | 52904842 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | methyl 2-[(3S)-1-(4-methylbenzoyl)-2,3-dihydroindol-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CN(C(=O)c2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H19NO3/c1-13-7-9-14(10-8-13)19(22)20-12-15(11-18(21)23-2)16-5-3-4-6-17(16)20/h3-10,15H,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | YCRRDTLPLPBACE-OAHLLOKOSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |