C49H48Cl2N6O2 — CID 10485591
2-(acridin-10-ium-9-ylamino)-N-[5-[[2-(acridin-10-ium-9-ylamino)-3-phenylpropanoyl]amino]pentyl]-3-phenylpropanamide dichloride (PubChem CID 10485591) has the molecular formula C49H48Cl2N6O2 and a molecular weight of 823.87 g/mol. Its IUPAC name is 2-(acridin-10-ium-9-ylamino)-N-[5-[[2-(acridin-10-ium-9-ylamino)-3-phenylpropanoyl]amino]pentyl]-3-phenylpropanamide dichloride.
| Compound Name | 2-(acridin-10-ium-9-ylamino)-N-[5-[[2-(acridin-10-ium-9-ylamino)-3-phenylpropanoyl]amino]pentyl]-3-phenylpropanamide dichloride |
|---|---|
| PubChem CID | 10485591 |
| Molecular Formula | C49H48Cl2N6O2 |
| Molecular Weight | 823.87 g/mol |
| Exact Mass | 822.32 |
| IUPAC Name | 2-(acridin-10-ium-9-ylamino)-N-[5-[[2-(acridin-10-ium-9-ylamino)-3-phenylpropanoyl]amino]pentyl]-3-phenylpropanamide dichloride |
| SMILES | O=C(NCCCCCNC(=O)C(Cc1ccccc1)Nc1c2ccccc2[nH+]c2ccccc12)C(Cc1ccccc1)Nc1c2ccccc2[nH+]c2ccccc12.[Cl-].[Cl-] |
| InChI | InChI=1S/C49H46N6O2.2ClH/c56-48(44(32-34-18-4-1-5-19-34)54-46-36-22-8-12-26-40(36)52-41-27-13-9-23-37(41)46)50-30-16-3-17-31-51-49(57)45(33-35-20-6-2-7-21-35)55-47-38-24-10-14-28-42(38)53-43-29-15-11-25-39(43)47;;/h1-2,4-15,18-29,44-45H,3,16-17,30-33H2,(H,50,56)(H,51,57)(H,52,54)(H,53,55);2*1H |
| InChIKey | WBSNEUGBEGZOBT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.87 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|