C11H21F2NO2 — CID 104857124
N-(2,2-difluoro-3-hydroxypropyl)-3,4,4-trimethylpentanamide (PubChem CID 104857124) has the molecular formula C11H21F2NO2 and a molecular weight of 237.29 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 104857124 |
| Molecular Formula | C11H21F2NO2 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NCC(F)(F)CO)C(C)(C)C |
| InChI | InChI=1S/C11H21F2NO2/c1-8(10(2,3)4)5-9(16)14-6-11(12,13)7-15/h8,15H,5-7H2,1-4H3,(H,14,16) |
| InChIKey | WCTAAVHGJAXDMO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |