C8H14F2N2O3S — CID 104857222
3-(2-amino-2-oxoethyl)sulfanyl-N-(2,2-difluoro-3-hydroxypropyl)propanamide (PubChem CID 104857222) has the molecular formula C8H14F2N2O3S and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-(2,2-difluoro-3-hydroxypropyl)propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(2,2-difluoro-3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 104857222 |
| Molecular Formula | C8H14F2N2O3S |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-(2,2-difluoro-3-hydroxypropyl)propanamide |
| SMILES | NC(=O)CSCCC(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C8H14F2N2O3S/c9-8(10,5-13)4-12-7(15)1-2-16-3-6(11)14/h13H,1-5H2,(H2,11,14)(H,12,15) |
| InChIKey | XJLOWBGYNGJKCK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|