C10H18F3NO3S — CID 103767819
N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103767819) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103767819 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NCCSCCCO |
| InChI | InChI=1S/C10H18F3NO3S/c11-10(12,13)8-17-5-2-9(16)14-3-7-18-6-1-4-15/h15H,1-8H2,(H,14,16) |
| InChIKey | HOXGHYIRFQBEEE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|