C9H16FNO3S — CID 59907762
S-[2-(propanoylamino)ethyl] (3S)-4-fluoro-3-hydroxybutanethioate (PubChem CID 59907762) has the molecular formula C9H16FNO3S and a molecular weight of 237.30 g/mol. Its IUPAC name is S-[2-(propanoylamino)ethyl] (3S)-4-fluoro-3-hydroxybutanethioate.
| Compound Name | S-[2-(propanoylamino)ethyl] (3S)-4-fluoro-3-hydroxybutanethioate |
|---|---|
| PubChem CID | 59907762 |
| Molecular Formula | C9H16FNO3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | S-[2-(propanoylamino)ethyl] (3S)-4-fluoro-3-hydroxybutanethioate |
| SMILES | CCC(=O)NCCSC(=O)C[C@H](O)CF |
| InChI | InChI=1S/C9H16FNO3S/c1-2-8(13)11-3-4-15-9(14)5-7(12)6-10/h7,12H,2-6H2,1H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | PDXNJIVVFITAOG-ZETCQYMHSA-N |
| XLogP | 0.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|