C10H19NO3S — CID 56603542
S-(2-acetamidoethyl) (3S)-3-hydroxyhexanethioate (PubChem CID 56603542) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (3S)-3-hydroxyhexanethioate.
| Compound Name | S-(2-acetamidoethyl) (3S)-3-hydroxyhexanethioate |
|---|---|
| PubChem CID | 56603542 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | S-(2-acetamidoethyl) (3S)-3-hydroxyhexanethioate |
| SMILES | CCC[C@H](O)CC(=O)SCCNC(C)=O |
| InChI | InChI=1S/C10H19NO3S/c1-3-4-9(13)7-10(14)15-6-5-11-8(2)12/h9,13H,3-7H2,1-2H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | SZQDQNORQYGFMI-VIFPVBQESA-N |
| XLogP | 0.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|