C11H20FNO3S — CID 59907794
S-[2-(propanoylamino)ethyl] (2R,3R)-5-fluoro-3-hydroxy-2-methylpentanethioate (PubChem CID 59907794) has the molecular formula C11H20FNO3S and a molecular weight of 265.35 g/mol. Its IUPAC name is S-[2-(propanoylamino)ethyl] (2R,3R)-5-fluoro-3-hydroxy-2-methylpentanethioate.
| Compound Name | S-[2-(propanoylamino)ethyl] (2R,3R)-5-fluoro-3-hydroxy-2-methylpentanethioate |
|---|---|
| PubChem CID | 59907794 |
| Molecular Formula | C11H20FNO3S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | S-[2-(propanoylamino)ethyl] (2R,3R)-5-fluoro-3-hydroxy-2-methylpentanethioate |
| SMILES | CCC(=O)NCCSC(=O)[C@H](C)[C@H](O)CCF |
| InChI | InChI=1S/C11H20FNO3S/c1-3-10(15)13-6-7-17-11(16)8(2)9(14)4-5-12/h8-9,14H,3-7H2,1-2H3,(H,13,15)/t8-,9-/m1/s1 |
| InChIKey | DDGKUYQTIJQDCD-RKDXNWHRSA-N |
| XLogP | 1.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|