C8H13F4NO2S — CID 103801078
2,2,3,3-tetrafluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]propanamide (PubChem CID 103801078) has the molecular formula C8H13F4NO2S and a molecular weight of 263.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 103801078 |
| Molecular Formula | C8H13F4NO2S |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]propanamide |
| SMILES | O=C(NCCSCCCO)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H13F4NO2S/c9-6(10)8(11,12)7(15)13-2-5-16-4-1-3-14/h6,14H,1-5H2,(H,13,15) |
| InChIKey | CGZASZKFCRDOJR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|