C9H17F2NO2S — CID 103769909
2-butylsulfanyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide (PubChem CID 103769909) has the molecular formula C9H17F2NO2S and a molecular weight of 241.30 g/mol. Its IUPAC name is 2-butylsulfanyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide.
| Compound Name | 2-butylsulfanyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 103769909 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-butylsulfanyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
| SMILES | CCCCSCC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C9H17F2NO2S/c1-2-3-4-15-6-8(14)12-5-7(13)9(10)11/h7,9,13H,2-6H2,1H3,(H,12,14) |
| InChIKey | HDKJPLDSUYIQCV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|