C14H22F2N2O — CID 104857903
3-[[4-(diethylamino)phenyl]methylamino]-2,2-difluoropropan-1-ol (PubChem CID 104857903) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-[[4-(diethylamino)phenyl]methylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[[4-(diethylamino)phenyl]methylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 104857903 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-[[4-(diethylamino)phenyl]methylamino]-2,2-difluoropropan-1-ol |
| SMILES | CCN(CC)c1ccc(CNCC(F)(F)CO)cc1 |
| InChI | InChI=1S/C14H22F2N2O/c1-3-18(4-2)13-7-5-12(6-8-13)9-17-10-14(15,16)11-19/h5-8,17,19H,3-4,9-11H2,1-2H3 |
| InChIKey | PIDXVKHIGKMRFT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|