C12H23F2NO2 — CID 104857975
N-(2,2-difluoro-3-hydroxypropyl)-3,5,5-trimethylhexanamide (PubChem CID 104857975) has the molecular formula C12H23F2NO2 and a molecular weight of 251.32 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 104857975 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCC(F)(F)CO)CC(C)(C)C |
| InChI | InChI=1S/C12H23F2NO2/c1-9(6-11(2,3)4)5-10(17)15-7-12(13,14)8-16/h9,16H,5-8H2,1-4H3,(H,15,17) |
| InChIKey | VZYKDMVJMPIIDK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |