C12H15N3O — CID 104860710
2-(aminomethyl)-N-pent-4-ynylpyridine-4-carboxamide (PubChem CID 104860710) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(aminomethyl)-N-pent-4-ynylpyridine-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-pent-4-ynylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 104860710 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(aminomethyl)-N-pent-4-ynylpyridine-4-carboxamide |
| SMILES | C#CCCCNC(=O)c1ccnc(CN)c1 |
| InChI | InChI=1S/C12H15N3O/c1-2-3-4-6-15-12(16)10-5-7-14-11(8-10)9-13/h1,5,7-8H,3-4,6,9,13H2,(H,15,16) |
| InChIKey | LROHIEKJGVJLRL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|