C11H24N4OS — CID 104863517
N'-hydroxy-2-methyl-2-[4-(2-methylsulfanylethyl)piperazin-1-yl]propanimidamide (PubChem CID 104863517) has the molecular formula C11H24N4OS and a molecular weight of 260.41 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-2-[4-(2-methylsulfanylethyl)piperazin-1-yl]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-2-[4-(2-methylsulfanylethyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 104863517 |
| Molecular Formula | C11H24N4OS |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N'-hydroxy-2-methyl-2-[4-(2-methylsulfanylethyl)piperazin-1-yl]propanimidamide |
| SMILES | CSCCN1CCN(C(C)(C)C(N)=NO)CC1 |
| InChI | InChI=1S/C11H24N4OS/c1-11(2,10(12)13-16)15-6-4-14(5-7-15)8-9-17-3/h16H,4-9H2,1-3H3,(H2,12,13) |
| InChIKey | IVLMEMPQYAFFTD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|